C14H22N2O4 — CID 94192184
1-ethyl-3-[(1R)-1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethyl]urea (PubChem CID 94192184) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-ethyl-3-[(1R)-1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethyl]urea.
| Compound Name | 1-ethyl-3-[(1R)-1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethyl]urea |
|---|---|
| PubChem CID | 94192184 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-ethyl-3-[(1R)-1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethyl]urea |
| SMILES | CCNC(=O)N[C@H](C)c1ccc(OCCO)c(OC)c1 |
| InChI | InChI=1S/C14H22N2O4/c1-4-15-14(18)16-10(2)11-5-6-12(20-8-7-17)13(9-11)19-3/h5-6,9-10,17H,4,7-8H2,1-3H3,(H2,15,16,18)/t10-/m1/s1 |
| InChIKey | ISXVYVMQUARGOD-SNVBAGLBSA-N |
| XLogP | 1.45 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |