C11H15NO5 — CID 66512825
(2S)-2-amino-2-[4-(2-hydroxyethoxy)-3-methoxyphenyl]acetic acid (PubChem CID 66512825) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is (2S)-2-amino-2-[4-(2-hydroxyethoxy)-3-methoxyphenyl]acetic acid.
| Compound Name | (2S)-2-amino-2-[4-(2-hydroxyethoxy)-3-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 66512825 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (2S)-2-amino-2-[4-(2-hydroxyethoxy)-3-methoxyphenyl]acetic acid |
| SMILES | COc1cc([C@H](N)C(=O)O)ccc1OCCO |
| InChI | InChI=1S/C11H15NO5/c1-16-9-6-7(10(12)11(14)15)2-3-8(9)17-5-4-13/h2-3,6,10,13H,4-5,12H2,1H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | QDCZKPPOSDNPFY-JTQLQIEISA-N |
| XLogP | 0.15 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |