C11H17NO4 — CID 66515047
(2S)-2-amino-2-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethanol (PubChem CID 66515047) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (2S)-2-amino-2-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethanol.
| Compound Name | (2S)-2-amino-2-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethanol |
|---|---|
| PubChem CID | 66515047 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (2S)-2-amino-2-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethanol |
| SMILES | COc1cc([C@H](N)CO)ccc1OCCO |
| InChI | InChI=1S/C11H17NO4/c1-15-11-6-8(9(12)7-14)2-3-10(11)16-5-4-13/h2-3,6,9,13-14H,4-5,7,12H2,1H3/t9-/m1/s1 |
| InChIKey | XVQOHGFVRZAKOG-SECBINFHSA-N |
| XLogP | 0.06 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |