C11H17NO3 — CID 77128086
2-amino-2-(4-ethoxy-3-methoxyphenyl)ethanol (PubChem CID 77128086) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-amino-2-(4-ethoxy-3-methoxyphenyl)ethanol.
| Compound Name | 2-amino-2-(4-ethoxy-3-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 77128086 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-amino-2-(4-ethoxy-3-methoxyphenyl)ethanol |
| SMILES | CCOc1ccc(C(N)CO)cc1OC |
| InChI | InChI=1S/C11H17NO3/c1-3-15-10-5-4-8(9(12)7-13)6-11(10)14-2/h4-6,9,13H,3,7,12H2,1-2H3 |
| InChIKey | YVWGJVRRSJCJRJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |