C19H26N2O4 — CID 14816116
1,3-bis(3,4-dimethoxyphenyl)propane-1,3-diamine (PubChem CID 14816116) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1,3-bis(3,4-dimethoxyphenyl)propane-1,3-diamine.
| Compound Name | 1,3-bis(3,4-dimethoxyphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 14816116 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1,3-bis(3,4-dimethoxyphenyl)propane-1,3-diamine |
| SMILES | COc1ccc(C(N)CC(N)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C19H26N2O4/c1-22-16-7-5-12(9-18(16)24-3)14(20)11-15(21)13-6-8-17(23-2)19(10-13)25-4/h5-10,14-15H,11,20-21H2,1-4H3 |
| InChIKey | VAORMQWBCFTJCP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |