C12H17NO2 — CID 11521312
(1S)-1-(3,4-dimethoxyphenyl)but-3-en-1-amine (PubChem CID 11521312) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (1S)-1-(3,4-dimethoxyphenyl)but-3-en-1-amine.
| Compound Name | (1S)-1-(3,4-dimethoxyphenyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 11521312 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (1S)-1-(3,4-dimethoxyphenyl)but-3-en-1-amine |
| SMILES | C=CC[C@H](N)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C12H17NO2/c1-4-5-10(13)9-6-7-11(14-2)12(8-9)15-3/h4,6-8,10H,1,5,13H2,2-3H3/t10-/m0/s1 |
| InChIKey | LRVXBKFCTIJVHJ-JTQLQIEISA-N |
| XLogP | 2.28 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|