C11H15NO2 — CID 55295606
4-(1-aminobut-3-enyl)-2-methoxyphenol (PubChem CID 55295606) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-(1-aminobut-3-enyl)-2-methoxyphenol.
| Compound Name | 4-(1-aminobut-3-enyl)-2-methoxyphenol |
|---|---|
| PubChem CID | 55295606 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-(1-aminobut-3-enyl)-2-methoxyphenol |
| SMILES | C=CCC(N)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C11H15NO2/c1-3-4-9(12)8-5-6-10(13)11(7-8)14-2/h3,5-7,9,13H,1,4,12H2,2H3 |
| InChIKey | QYWAPDLLCWJFHA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|