C9H15ClN2O2 — CID 171222633
4-[(1R)-1,2-diaminoethyl]-2-methoxyphenol;hydrochloride (PubChem CID 171222633) has the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. Its IUPAC name is 4-[(1R)-1,2-diaminoethyl]-2-methoxyphenol;hydrochloride.
| Compound Name | 4-[(1R)-1,2-diaminoethyl]-2-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171222633 |
| Molecular Formula | C9H15ClN2O2 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 4-[(1R)-1,2-diaminoethyl]-2-methoxyphenol;hydrochloride |
| SMILES | COc1cc([C@@H](N)CN)ccc1O.Cl |
| InChI | InChI=1S/C9H14N2O2.ClH/c1-13-9-4-6(7(11)5-10)2-3-8(9)12;/h2-4,7,12H,5,10-11H2,1H3;1H/t7-;/m0./s1 |
| InChIKey | YWJKIRQTTPRPHA-FJXQXJEOSA-N |
| XLogP | 0.78 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |