C12H20ClNO2 — CID 171222672
4-[(1S)-1-amino-2-methylbutyl]-2-methoxyphenol;hydrochloride (PubChem CID 171222672) has the molecular formula C12H20ClNO2 and a molecular weight of 245.75 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2-methylbutyl]-2-methoxyphenol;hydrochloride.
| Compound Name | 4-[(1S)-1-amino-2-methylbutyl]-2-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171222672 |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-[(1S)-1-amino-2-methylbutyl]-2-methoxyphenol;hydrochloride |
| SMILES | CCC(C)[C@H](N)c1ccc(O)c(OC)c1.Cl |
| InChI | InChI=1S/C12H19NO2.ClH/c1-4-8(2)12(13)9-5-6-10(14)11(7-9)15-3;/h5-8,12,14H,4,13H2,1-3H3;1H/t8?,12-;/m0./s1 |
| InChIKey | LTZQVHKCGILVNM-COSMAPIXSA-N |
| XLogP | 2.87 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |