C13H21NO3 — CID 171219341
4-[(1S)-1-amino-2-methylbutyl]-2,6-dimethoxyphenol (PubChem CID 171219341) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2-methylbutyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(1S)-1-amino-2-methylbutyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 171219341 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-[(1S)-1-amino-2-methylbutyl]-2,6-dimethoxyphenol |
| SMILES | CCC(C)[C@H](N)c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C13H21NO3/c1-5-8(2)12(14)9-6-10(16-3)13(15)11(7-9)17-4/h6-8,12,15H,5,14H2,1-4H3/t8?,12-/m0/s1 |
| InChIKey | GKWVESPDUMOXDX-MYIOLCAUSA-N |
| XLogP | 2.46 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |