C11H17NO3 — CID 171199776
4-[(1R)-1-aminopropyl]-2,6-dimethoxyphenol (PubChem CID 171199776) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-[(1R)-1-aminopropyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(1R)-1-aminopropyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 171199776 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4-[(1R)-1-aminopropyl]-2,6-dimethoxyphenol |
| SMILES | CC[C@@H](N)c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C11H17NO3/c1-4-8(12)7-5-9(14-2)11(13)10(6-7)15-3/h5-6,8,13H,4,12H2,1-3H3/t8-/m1/s1 |
| InChIKey | KMHYKQOBCIYQBD-MRVPVSSYSA-N |
| XLogP | 1.82 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |