C9H13IN2O2 — CID 131213942
4-[(1R)-1,2-diaminoethyl]-2-iodo-6-methoxyphenol (PubChem CID 131213942) has the molecular formula C9H13IN2O2 and a molecular weight of 308.12 g/mol. Its IUPAC name is 4-[(1R)-1,2-diaminoethyl]-2-iodo-6-methoxyphenol.
| Compound Name | 4-[(1R)-1,2-diaminoethyl]-2-iodo-6-methoxyphenol |
|---|---|
| PubChem CID | 131213942 |
| Molecular Formula | C9H13IN2O2 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 4-[(1R)-1,2-diaminoethyl]-2-iodo-6-methoxyphenol |
| SMILES | COc1cc([C@@H](N)CN)cc(I)c1O |
| InChI | InChI=1S/C9H13IN2O2/c1-14-8-3-5(7(12)4-11)2-6(10)9(8)13/h2-3,7,13H,4,11-12H2,1H3/t7-/m0/s1 |
| InChIKey | OCDPVPPTEMNSGP-ZETCQYMHSA-N |
| XLogP | 0.96 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|