C10H14I2N2O — CID 171215819
4-[(1R)-1,4-diaminobutyl]-2,6-diiodophenol (PubChem CID 171215819) has the molecular formula C10H14I2N2O and a molecular weight of 432.04 g/mol. Its IUPAC name is 4-[(1R)-1,4-diaminobutyl]-2,6-diiodophenol.
| Compound Name | 4-[(1R)-1,4-diaminobutyl]-2,6-diiodophenol |
|---|---|
| PubChem CID | 171215819 |
| Molecular Formula | C10H14I2N2O |
| Molecular Weight | 432.04 g/mol |
| Exact Mass | 431.92 |
| IUPAC Name | 4-[(1R)-1,4-diaminobutyl]-2,6-diiodophenol |
| SMILES | NCCC[C@@H](N)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C10H14I2N2O/c11-7-4-6(5-8(12)10(7)15)9(14)2-1-3-13/h4-5,9,15H,1-3,13-14H2/t9-/m1/s1 |
| InChIKey | HFEANUZASBQWFC-SECBINFHSA-N |
| XLogP | 2.34 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.04 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|