C11H17ClI2N2O — CID 171215822
4-[(1R)-1,5-diaminopentyl]-2,6-diiodophenol;hydrochloride (PubChem CID 171215822) has the molecular formula C11H17ClI2N2O and a molecular weight of 482.53 g/mol. Its IUPAC name is 4-[(1R)-1,5-diaminopentyl]-2,6-diiodophenol;hydrochloride.
| Compound Name | 4-[(1R)-1,5-diaminopentyl]-2,6-diiodophenol;hydrochloride |
|---|---|
| PubChem CID | 171215822 |
| Molecular Formula | C11H17ClI2N2O |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 481.91 |
| IUPAC Name | 4-[(1R)-1,5-diaminopentyl]-2,6-diiodophenol;hydrochloride |
| SMILES | Cl.NCCCC[C@@H](N)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C11H16I2N2O.ClH/c12-8-5-7(6-9(13)11(8)16)10(15)3-1-2-4-14;/h5-6,10,16H,1-4,14-15H2;1H/t10-;/m1./s1 |
| InChIKey | BFXRBYLCESKKEB-HNCPQSOCSA-N |
| XLogP | 3.15 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|