C10H15ClI2N2O — CID 171235496
2-[(1S)-1,4-diaminobutyl]-4,6-diiodophenol;hydrochloride (PubChem CID 171235496) has the molecular formula C10H15ClI2N2O and a molecular weight of 468.50 g/mol. Its IUPAC name is 2-[(1S)-1,4-diaminobutyl]-4,6-diiodophenol;hydrochloride.
| Compound Name | 2-[(1S)-1,4-diaminobutyl]-4,6-diiodophenol;hydrochloride |
|---|---|
| PubChem CID | 171235496 |
| Molecular Formula | C10H15ClI2N2O |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 467.90 |
| IUPAC Name | 2-[(1S)-1,4-diaminobutyl]-4,6-diiodophenol;hydrochloride |
| SMILES | Cl.NCCC[C@H](N)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C10H14I2N2O.ClH/c11-6-4-7(9(14)2-1-3-13)10(15)8(12)5-6;/h4-5,9,15H,1-3,13-14H2;1H/t9-;/m0./s1 |
| InChIKey | WOEXIIDQICVTQW-FVGYRXGTSA-N |
| XLogP | 2.76 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|