C8H9I2NO — CID 130709990
2-[(1S)-1-aminoethyl]-4,6-diiodophenol (PubChem CID 130709990) has the molecular formula C8H9I2NO and a molecular weight of 388.97 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-4,6-diiodophenol.
| Compound Name | 2-[(1S)-1-aminoethyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 130709990 |
| Molecular Formula | C8H9I2NO |
| Molecular Weight | 388.97 g/mol |
| Exact Mass | 388.88 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-4,6-diiodophenol |
| SMILES | C[C@H](N)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C8H9I2NO/c1-4(11)6-2-5(9)3-7(10)8(6)12/h2-4,12H,11H2,1H3/t4-/m0/s1 |
| InChIKey | IQZLQANVTVIIOF-BYPYZUCNSA-N |
| XLogP | 2.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.97 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|