C10H13I2NO — CID 131101034
2-[(1S)-1-aminobutyl]-4,6-diiodophenol (PubChem CID 131101034) has the molecular formula C10H13I2NO and a molecular weight of 417.03 g/mol. Its IUPAC name is 2-[(1S)-1-aminobutyl]-4,6-diiodophenol.
| Compound Name | 2-[(1S)-1-aminobutyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 131101034 |
| Molecular Formula | C10H13I2NO |
| Molecular Weight | 417.03 g/mol |
| Exact Mass | 416.91 |
| IUPAC Name | 2-[(1S)-1-aminobutyl]-4,6-diiodophenol |
| SMILES | CCC[C@H](N)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C10H13I2NO/c1-2-3-9(13)7-4-6(11)5-8(12)10(7)14/h4-5,9,14H,2-3,13H2,1H3/t9-/m0/s1 |
| InChIKey | KOXDQEPQFVJXGD-VIFPVBQESA-N |
| XLogP | 3.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.03 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|