C10H13Cl2NO — CID 130677295
2-[(1R)-1-aminobutyl]-4,6-dichlorophenol (PubChem CID 130677295) has the molecular formula C10H13Cl2NO and a molecular weight of 234.13 g/mol. Its IUPAC name is 2-[(1R)-1-aminobutyl]-4,6-dichlorophenol.
| Compound Name | 2-[(1R)-1-aminobutyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 130677295 |
| Molecular Formula | C10H13Cl2NO |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-[(1R)-1-aminobutyl]-4,6-dichlorophenol |
| SMILES | CCC[C@@H](N)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C10H13Cl2NO/c1-2-3-9(13)7-4-6(11)5-8(12)10(7)14/h4-5,9,14H,2-3,13H2,1H3/t9-/m1/s1 |
| InChIKey | HQBYDEYDWCSLRT-SECBINFHSA-N |
| XLogP | 3.50 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|