C10H13Cl2NO2 — CID 171197734
2-[(1R)-1-amino-4-hydroxybutyl]-4,6-dichlorophenol (PubChem CID 171197734) has the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. Its IUPAC name is 2-[(1R)-1-amino-4-hydroxybutyl]-4,6-dichlorophenol.
| Compound Name | 2-[(1R)-1-amino-4-hydroxybutyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 171197734 |
| Molecular Formula | C10H13Cl2NO2 |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 2-[(1R)-1-amino-4-hydroxybutyl]-4,6-dichlorophenol |
| SMILES | N[C@H](CCCO)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C10H13Cl2NO2/c11-6-4-7(9(13)2-1-3-14)10(15)8(12)5-6/h4-5,9,14-15H,1-3,13H2/t9-/m1/s1 |
| InChIKey | KPETYZCJYXYKSG-SECBINFHSA-N |
| XLogP | 2.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|