C8H10Cl3NO — CID 171217209
2-[(1S)-1-aminoethyl]-4,6-dichlorophenol;hydrochloride (PubChem CID 171217209) has the molecular formula C8H10Cl3NO and a molecular weight of 242.53 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-4,6-dichlorophenol;hydrochloride.
| Compound Name | 2-[(1S)-1-aminoethyl]-4,6-dichlorophenol;hydrochloride |
|---|---|
| PubChem CID | 171217209 |
| Molecular Formula | C8H10Cl3NO |
| Molecular Weight | 242.53 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-4,6-dichlorophenol;hydrochloride |
| SMILES | C[C@H](N)c1cc(Cl)cc(Cl)c1O.Cl |
| InChI | InChI=1S/C8H9Cl2NO.ClH/c1-4(11)6-2-5(9)3-7(10)8(6)12;/h2-4,12H,11H2,1H3;1H/t4-;/m0./s1 |
| InChIKey | SUIGFTNQQUYYCK-WCCKRBBISA-N |
| XLogP | 3.14 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|