C10H12Cl3NO — CID 171217225
2-[(S)-amino(cyclopropyl)methyl]-4,6-dichlorophenol;hydrochloride (PubChem CID 171217225) has the molecular formula C10H12Cl3NO and a molecular weight of 268.57 g/mol. Its IUPAC name is 2-[(S)-amino(cyclopropyl)methyl]-4,6-dichlorophenol;hydrochloride.
| Compound Name | 2-[(S)-amino(cyclopropyl)methyl]-4,6-dichlorophenol;hydrochloride |
|---|---|
| PubChem CID | 171217225 |
| Molecular Formula | C10H12Cl3NO |
| Molecular Weight | 268.57 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | 2-[(S)-amino(cyclopropyl)methyl]-4,6-dichlorophenol;hydrochloride |
| SMILES | Cl.N[C@H](c1cc(Cl)cc(Cl)c1O)C1CC1 |
| InChI | InChI=1S/C10H11Cl2NO.ClH/c11-6-3-7(9(13)5-1-2-5)10(14)8(12)4-6;/h3-5,9,14H,1-2,13H2;1H/t9-;/m0./s1 |
| InChIKey | XYKIWUATTIPQGQ-FVGYRXGTSA-N |
| XLogP | 3.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|