C12H14Cl3NO — CID 171251001
(R)-oxan-4-yl-(2,3,5-trichlorophenyl)methanamine (PubChem CID 171251001) has the molecular formula C12H14Cl3NO and a molecular weight of 294.61 g/mol. Its IUPAC name is (R)-oxan-4-yl-(2,3,5-trichlorophenyl)methanamine.
| Compound Name | (R)-oxan-4-yl-(2,3,5-trichlorophenyl)methanamine |
|---|---|
| PubChem CID | 171251001 |
| Molecular Formula | C12H14Cl3NO |
| Molecular Weight | 294.61 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | (R)-oxan-4-yl-(2,3,5-trichlorophenyl)methanamine |
| SMILES | N[C@@H](c1cc(Cl)cc(Cl)c1Cl)C1CCOCC1 |
| InChI | InChI=1S/C12H14Cl3NO/c13-8-5-9(11(15)10(14)6-8)12(16)7-1-3-17-4-2-7/h5-7,12H,1-4,16H2/t12-/m1/s1 |
| InChIKey | YBXBDYJKHLSWEV-GFCCVEGCSA-N |
| XLogP | 4.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|