C12H13BrCl2O — CID 62905706
4-[bromo-(2,5-dichlorophenyl)methyl]oxane (PubChem CID 62905706) has the molecular formula C12H13BrCl2O and a molecular weight of 324.05 g/mol. Its IUPAC name is 4-[bromo-(2,5-dichlorophenyl)methyl]oxane.
| Compound Name | 4-[bromo-(2,5-dichlorophenyl)methyl]oxane |
|---|---|
| PubChem CID | 62905706 |
| Molecular Formula | C12H13BrCl2O |
| Molecular Weight | 324.05 g/mol |
| Exact Mass | 321.95 |
| IUPAC Name | 4-[bromo-(2,5-dichlorophenyl)methyl]oxane |
| SMILES | Clc1ccc(Cl)c(C(Br)C2CCOCC2)c1 |
| InChI | InChI=1S/C12H13BrCl2O/c13-12(8-3-5-16-6-4-8)10-7-9(14)1-2-11(10)15/h1-2,7-8,12H,3-6H2 |
| InChIKey | ZQLAKXWUSQOTMC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.05 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|