C11H11Cl3O — CID 61278920
3-[chloro-(2,5-dichlorophenyl)methyl]oxolane (PubChem CID 61278920) has the molecular formula C11H11Cl3O and a molecular weight of 265.57 g/mol. Its IUPAC name is 3-[chloro-(2,5-dichlorophenyl)methyl]oxolane.
| Compound Name | 3-[chloro-(2,5-dichlorophenyl)methyl]oxolane |
|---|---|
| PubChem CID | 61278920 |
| Molecular Formula | C11H11Cl3O |
| Molecular Weight | 265.57 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 3-[chloro-(2,5-dichlorophenyl)methyl]oxolane |
| SMILES | Clc1ccc(Cl)c(C(Cl)C2CCOC2)c1 |
| InChI | InChI=1S/C11H11Cl3O/c12-8-1-2-10(13)9(5-8)11(14)7-3-4-15-6-7/h1-2,5,7,11H,3-4,6H2 |
| InChIKey | MBEJBBLXJANIET-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|