C12H13ClF2O — CID 63014568
3-[chloro-(2,4-difluorophenyl)methyl]oxane (PubChem CID 63014568) has the molecular formula C12H13ClF2O and a molecular weight of 246.68 g/mol. Its IUPAC name is 3-[chloro-(2,4-difluorophenyl)methyl]oxane.
| Compound Name | 3-[chloro-(2,4-difluorophenyl)methyl]oxane |
|---|---|
| PubChem CID | 63014568 |
| Molecular Formula | C12H13ClF2O |
| Molecular Weight | 246.68 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3-[chloro-(2,4-difluorophenyl)methyl]oxane |
| SMILES | Fc1ccc(C(Cl)C2CCCOC2)c(F)c1 |
| InChI | InChI=1S/C12H13ClF2O/c13-12(8-2-1-5-16-7-8)10-4-3-9(14)6-11(10)15/h3-4,6,8,12H,1-2,5,7H2 |
| InChIKey | OFLJHZUHJXAFPO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|