C14H18ClFO3 — CID 63014038
3-[chloro-(2-fluoro-4,5-dimethoxyphenyl)methyl]oxane (PubChem CID 63014038) has the molecular formula C14H18ClFO3 and a molecular weight of 288.75 g/mol. Its IUPAC name is 3-[chloro-(2-fluoro-4,5-dimethoxyphenyl)methyl]oxane.
| Compound Name | 3-[chloro-(2-fluoro-4,5-dimethoxyphenyl)methyl]oxane |
|---|---|
| PubChem CID | 63014038 |
| Molecular Formula | C14H18ClFO3 |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-[chloro-(2-fluoro-4,5-dimethoxyphenyl)methyl]oxane |
| SMILES | COc1cc(F)c(C(Cl)C2CCCOC2)cc1OC |
| InChI | InChI=1S/C14H18ClFO3/c1-17-12-6-10(11(16)7-13(12)18-2)14(15)9-4-3-5-19-8-9/h6-7,9,14H,3-5,8H2,1-2H3 |
| InChIKey | FNJMIVYFXGHRSV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|