C13H16Cl2O3 — CID 61278720
3-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]oxolane (PubChem CID 61278720) has the molecular formula C13H16Cl2O3 and a molecular weight of 291.17 g/mol. Its IUPAC name is 3-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]oxolane.
| Compound Name | 3-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]oxolane |
|---|---|
| PubChem CID | 61278720 |
| Molecular Formula | C13H16Cl2O3 |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]oxolane |
| SMILES | COc1cc(Cl)c(C(Cl)C2CCOC2)cc1OC |
| InChI | InChI=1S/C13H16Cl2O3/c1-16-11-5-9(10(14)6-12(11)17-2)13(15)8-3-4-18-7-8/h5-6,8,13H,3-4,7H2,1-2H3 |
| InChIKey | XXKJJMUCSQCUQZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|