C14H20O5 — CID 63896019
oxolan-3-yl-(2,4,5-trimethoxyphenyl)methanol (PubChem CID 63896019) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is oxolan-3-yl-(2,4,5-trimethoxyphenyl)methanol.
| Compound Name | oxolan-3-yl-(2,4,5-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 63896019 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | oxolan-3-yl-(2,4,5-trimethoxyphenyl)methanol |
| SMILES | COc1cc(OC)c(C(O)C2CCOC2)cc1OC |
| InChI | InChI=1S/C14H20O5/c1-16-11-7-13(18-3)12(17-2)6-10(11)14(15)9-4-5-19-8-9/h6-7,9,14-15H,4-5,8H2,1-3H3 |
| InChIKey | GCIYIZXDEFRJEL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |