C12H15ClO3 — CID 115798171
(4-chloro-2-methoxyphenyl)-(oxolan-3-yl)methanol (PubChem CID 115798171) has the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. Its IUPAC name is (4-chloro-2-methoxyphenyl)-(oxolan-3-yl)methanol.
| Compound Name | (4-chloro-2-methoxyphenyl)-(oxolan-3-yl)methanol |
|---|---|
| PubChem CID | 115798171 |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (4-chloro-2-methoxyphenyl)-(oxolan-3-yl)methanol |
| SMILES | COc1cc(Cl)ccc1C(O)C1CCOC1 |
| InChI | InChI=1S/C12H15ClO3/c1-15-11-6-9(13)2-3-10(11)12(14)8-4-5-16-7-8/h2-3,6,8,12,14H,4-5,7H2,1H3 |
| InChIKey | UZCZNAARQCWXBF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |