C13H17ClO4 — CID 63563606
(3-chloro-4,5-dimethoxyphenyl)-(oxolan-3-yl)methanol (PubChem CID 63563606) has the molecular formula C13H17ClO4 and a molecular weight of 272.73 g/mol. Its IUPAC name is (3-chloro-4,5-dimethoxyphenyl)-(oxolan-3-yl)methanol.
| Compound Name | (3-chloro-4,5-dimethoxyphenyl)-(oxolan-3-yl)methanol |
|---|---|
| PubChem CID | 63563606 |
| Molecular Formula | C13H17ClO4 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (3-chloro-4,5-dimethoxyphenyl)-(oxolan-3-yl)methanol |
| SMILES | COc1cc(C(O)C2CCOC2)cc(Cl)c1OC |
| InChI | InChI=1S/C13H17ClO4/c1-16-11-6-9(5-10(14)13(11)17-2)12(15)8-3-4-18-7-8/h5-6,8,12,15H,3-4,7H2,1-2H3 |
| InChIKey | FGEPHUHGYJBYLQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |