C16H24O4 — CID 63895814
cyclohexyl-(3,4,5-trimethoxyphenyl)methanol (PubChem CID 63895814) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is cyclohexyl-(3,4,5-trimethoxyphenyl)methanol.
| Compound Name | cyclohexyl-(3,4,5-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 63895814 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | cyclohexyl-(3,4,5-trimethoxyphenyl)methanol |
| SMILES | COc1cc(C(O)C2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C16H24O4/c1-18-13-9-12(10-14(19-2)16(13)20-3)15(17)11-7-5-4-6-8-11/h9-11,15,17H,4-8H2,1-3H3 |
| InChIKey | NYPNEIAQXPWBJC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |