C18H26N6O4 — CID 121320829
[3,5-bis(azidomethoxy)-4-methoxyphenyl]-cyclooctylmethanol (PubChem CID 121320829) has the molecular formula C18H26N6O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is [3,5-bis(azidomethoxy)-4-methoxyphenyl]-cyclooctylmethanol.
| Compound Name | [3,5-bis(azidomethoxy)-4-methoxyphenyl]-cyclooctylmethanol |
|---|---|
| PubChem CID | 121320829 |
| Molecular Formula | C18H26N6O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [3,5-bis(azidomethoxy)-4-methoxyphenyl]-cyclooctylmethanol |
| SMILES | COc1c(OCN=[N+]=[N-])cc(C(O)C2CCCCCCC2)cc1OCN=[N+]=[N-] |
| InChI | InChI=1S/C18H26N6O4/c1-26-18-15(27-11-21-23-19)9-14(10-16(18)28-12-22-24-20)17(25)13-7-5-3-2-4-6-8-13/h9-10,13,17,25H,2-8,11-12H2,1H3 |
| InChIKey | QWQIPJSMWAZRAB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 145.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|