C17H26O4 — CID 82932669
cycloheptyl-(2,4,5-trimethoxyphenyl)methanol (PubChem CID 82932669) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is cycloheptyl-(2,4,5-trimethoxyphenyl)methanol.
| Compound Name | cycloheptyl-(2,4,5-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 82932669 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | cycloheptyl-(2,4,5-trimethoxyphenyl)methanol |
| SMILES | COc1cc(OC)c(C(O)C2CCCCCC2)cc1OC |
| InChI | InChI=1S/C17H26O4/c1-19-14-11-16(21-3)15(20-2)10-13(14)17(18)12-8-6-4-5-7-9-12/h10-12,17-18H,4-9H2,1-3H3 |
| InChIKey | QGLIMAGJUPFYHE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |