C16H25NO4 — CID 61056380
2-(cyclopentylamino)-2-(2,4,5-trimethoxyphenyl)ethanol (PubChem CID 61056380) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-(cyclopentylamino)-2-(2,4,5-trimethoxyphenyl)ethanol.
| Compound Name | 2-(cyclopentylamino)-2-(2,4,5-trimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 61056380 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-(cyclopentylamino)-2-(2,4,5-trimethoxyphenyl)ethanol |
| SMILES | COc1cc(OC)c(C(CO)NC2CCCC2)cc1OC |
| InChI | InChI=1S/C16H25NO4/c1-19-14-9-16(21-3)15(20-2)8-12(14)13(10-18)17-11-6-4-5-7-11/h8-9,11,13,17-18H,4-7,10H2,1-3H3 |
| InChIKey | SIUIVAHUSVBJDZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |