C16H24BrNO3 — CID 61047473
2-(2-bromo-4,5-dimethoxyphenyl)-2-(cyclohexylamino)ethanol (PubChem CID 61047473) has the molecular formula C16H24BrNO3 and a molecular weight of 358.28 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)-2-(cyclohexylamino)ethanol.
| Compound Name | 2-(2-bromo-4,5-dimethoxyphenyl)-2-(cyclohexylamino)ethanol |
|---|---|
| PubChem CID | 61047473 |
| Molecular Formula | C16H24BrNO3 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-(2-bromo-4,5-dimethoxyphenyl)-2-(cyclohexylamino)ethanol |
| SMILES | COc1cc(Br)c(C(CO)NC2CCCCC2)cc1OC |
| InChI | InChI=1S/C16H24BrNO3/c1-20-15-8-12(13(17)9-16(15)21-2)14(10-19)18-11-6-4-3-5-7-11/h8-9,11,14,18-19H,3-7,10H2,1-2H3 |
| InChIKey | RUFWGVDNAUPADX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |