C15H21BrO3 — CID 105056972
(4-bromo-2,5-dimethoxyphenyl)-cyclohexylmethanol (PubChem CID 105056972) has the molecular formula C15H21BrO3 and a molecular weight of 329.23 g/mol. Its IUPAC name is (4-bromo-2,5-dimethoxyphenyl)-cyclohexylmethanol.
| Compound Name | (4-bromo-2,5-dimethoxyphenyl)-cyclohexylmethanol |
|---|---|
| PubChem CID | 105056972 |
| Molecular Formula | C15H21BrO3 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (4-bromo-2,5-dimethoxyphenyl)-cyclohexylmethanol |
| SMILES | COc1cc(C(O)C2CCCCC2)c(OC)cc1Br |
| InChI | InChI=1S/C15H21BrO3/c1-18-13-9-12(16)14(19-2)8-11(13)15(17)10-6-4-3-5-7-10/h8-10,15,17H,3-7H2,1-2H3 |
| InChIKey | BTMDPMMUHKBCDB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |