C16H20Br2O2 — CID 105057450
7-[bromo-(4-bromo-2,5-dimethoxyphenyl)methyl]bicyclo[4.1.0]heptane (PubChem CID 105057450) has the molecular formula C16H20Br2O2 and a molecular weight of 404.14 g/mol. Its IUPAC name is 7-[bromo-(4-bromo-2,5-dimethoxyphenyl)methyl]bicyclo[4.1.0]heptane.
| Compound Name | 7-[bromo-(4-bromo-2,5-dimethoxyphenyl)methyl]bicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 105057450 |
| Molecular Formula | C16H20Br2O2 |
| Molecular Weight | 404.14 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | 7-[bromo-(4-bromo-2,5-dimethoxyphenyl)methyl]bicyclo[4.1.0]heptane |
| SMILES | COc1cc(C(Br)C2C3CCCCC32)c(OC)cc1Br |
| InChI | InChI=1S/C16H20Br2O2/c1-19-13-8-12(17)14(20-2)7-11(13)16(18)15-9-5-3-4-6-10(9)15/h7-10,15-16H,3-6H2,1-2H3 |
| InChIKey | OHGNODANHZVYJV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.14 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|