C16H22BrClO2 — CID 107182652
1-bromo-4-[chloro-(2,2-dimethylcyclopentyl)methyl]-2,5-dimethoxybenzene (PubChem CID 107182652) has the molecular formula C16H22BrClO2 and a molecular weight of 361.71 g/mol. Its IUPAC name is 1-bromo-4-[chloro-(2,2-dimethylcyclopentyl)methyl]-2,5-dimethoxybenzene.
| Compound Name | 1-bromo-4-[chloro-(2,2-dimethylcyclopentyl)methyl]-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 107182652 |
| Molecular Formula | C16H22BrClO2 |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 1-bromo-4-[chloro-(2,2-dimethylcyclopentyl)methyl]-2,5-dimethoxybenzene |
| SMILES | COc1cc(C(Cl)C2CCCC2(C)C)c(OC)cc1Br |
| InChI | InChI=1S/C16H22BrClO2/c1-16(2)7-5-6-11(16)15(18)10-8-14(20-4)12(17)9-13(10)19-3/h8-9,11,15H,5-7H2,1-4H3 |
| InChIKey | YLZLEYHDSNGLER-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|