C18H27BrO2 — CID 107182324
1-[bromo-(2,2-dimethylcyclohexyl)methyl]-4,5-dimethoxy-2-methylbenzene (PubChem CID 107182324) has the molecular formula C18H27BrO2 and a molecular weight of 355.32 g/mol. Its IUPAC name is 1-[bromo-(2,2-dimethylcyclohexyl)methyl]-4,5-dimethoxy-2-methylbenzene.
| Compound Name | 1-[bromo-(2,2-dimethylcyclohexyl)methyl]-4,5-dimethoxy-2-methylbenzene |
|---|---|
| PubChem CID | 107182324 |
| Molecular Formula | C18H27BrO2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-[bromo-(2,2-dimethylcyclohexyl)methyl]-4,5-dimethoxy-2-methylbenzene |
| SMILES | COc1cc(C)c(C(Br)C2CCCCC2(C)C)cc1OC |
| InChI | InChI=1S/C18H27BrO2/c1-12-10-15(20-4)16(21-5)11-13(12)17(19)14-8-6-7-9-18(14,2)3/h10-11,14,17H,6-9H2,1-5H3 |
| InChIKey | FHKHCUKXOSHTNN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|