C14H18BrClO2 — CID 107002722
1-[bromo-(2,2-dimethylcyclopropyl)methyl]-2-chloro-4,5-dimethoxybenzene (PubChem CID 107002722) has the molecular formula C14H18BrClO2 and a molecular weight of 333.65 g/mol. Its IUPAC name is 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-2-chloro-4,5-dimethoxybenzene.
| Compound Name | 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-2-chloro-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 107002722 |
| Molecular Formula | C14H18BrClO2 |
| Molecular Weight | 333.65 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 1-[bromo-(2,2-dimethylcyclopropyl)methyl]-2-chloro-4,5-dimethoxybenzene |
| SMILES | COc1cc(Cl)c(C(Br)C2CC2(C)C)cc1OC |
| InChI | InChI=1S/C14H18BrClO2/c1-14(2)7-9(14)13(15)8-5-11(17-3)12(18-4)6-10(8)16/h5-6,9,13H,7H2,1-4H3 |
| InChIKey | ARFMEWOKOUXQMN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|