C16H23ClO3 — CID 106828309
(2-chloro-4,5-dimethoxyphenyl)-(1-methylcyclohexyl)methanol (PubChem CID 106828309) has the molecular formula C16H23ClO3 and a molecular weight of 298.81 g/mol. Its IUPAC name is (2-chloro-4,5-dimethoxyphenyl)-(1-methylcyclohexyl)methanol.
| Compound Name | (2-chloro-4,5-dimethoxyphenyl)-(1-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 106828309 |
| Molecular Formula | C16H23ClO3 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2-chloro-4,5-dimethoxyphenyl)-(1-methylcyclohexyl)methanol |
| SMILES | COc1cc(Cl)c(C(O)C2(C)CCCCC2)cc1OC |
| InChI | InChI=1S/C16H23ClO3/c1-16(7-5-4-6-8-16)15(18)11-9-13(19-2)14(20-3)10-12(11)17/h9-10,15,18H,4-8H2,1-3H3 |
| InChIKey | ARJIXZHIULHHKK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |