C16H23ClO — CID 106828351
(4-chloro-2,5-dimethylphenyl)-(1-methylcyclohexyl)methanol (PubChem CID 106828351) has the molecular formula C16H23ClO and a molecular weight of 266.81 g/mol. Its IUPAC name is (4-chloro-2,5-dimethylphenyl)-(1-methylcyclohexyl)methanol.
| Compound Name | (4-chloro-2,5-dimethylphenyl)-(1-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 106828351 |
| Molecular Formula | C16H23ClO |
| Molecular Weight | 266.81 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (4-chloro-2,5-dimethylphenyl)-(1-methylcyclohexyl)methanol |
| SMILES | Cc1cc(C(O)C2(C)CCCCC2)c(C)cc1Cl |
| InChI | InChI=1S/C16H23ClO/c1-11-10-14(17)12(2)9-13(11)15(18)16(3)7-5-4-6-8-16/h9-10,15,18H,4-8H2,1-3H3 |
| InChIKey | PQLZAVXCDNDJTQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.81 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |