About (3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol
(3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol (PubChem CID 142848793) has the molecular formula C17H27ClO3
and a molecular weight of 314.85 g/mol. Its IUPAC name is (3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol.
Molecular Properties
| Compound Name | (3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol |
| PubChem CID | 142848793 |
| Molecular Formula | C17H27ClO3 |
| Molecular Weight | 314.85 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol |
| SMILES | C=O.CO.Cc1cc(Cl)cc(C(O)C2(C)CCCCC2)c1 |
| InChI | InChI=1S/C15H21ClO.CH4O.CH2O/c1-11-8-12(10-13(16)9-11)14(17)15(2)6-4-3-5-7-15;2*1-2/h8-10,14,17H,3-7H2,1-2H3;2H,1H3;1H2 |
| InChIKey | FSVGDZJHJIFLBW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.85 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol?
The IUPAC name of (3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol (CID 142848793) is (3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol.
What is the SMILES notation for (3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol?
The canonical SMILES for (3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol is C=O.CO.Cc1cc(Cl)cc(C(O)C2(C)CCCCC2)c1.
What is the InChIKey of (3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol?
The InChIKey is FSVGDZJHJIFLBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClO.CH4O.CH2O/c1-11-8-12(10-13(16)9-11)14(17)15(2)6-4-3-5-7-15;2*1-2/h8-10,14,17H,3-7H2,1-2H3;2H,1H3;1H2.
What are the key properties of (3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol?
(3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol has a molecular weight of 314.85 g/mol, XLogP of 4.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-5-methylphenyl)-(1-methylcyclohexyl)methanol;formaldehyde;methanol is sourced from PubChem (CID 142848793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).