C18H28O — CID 106828378
(3,4-diethylphenyl)-(1-methylcyclohexyl)methanol (PubChem CID 106828378) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is (3,4-diethylphenyl)-(1-methylcyclohexyl)methanol.
| Compound Name | (3,4-diethylphenyl)-(1-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 106828378 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | (3,4-diethylphenyl)-(1-methylcyclohexyl)methanol |
| SMILES | CCc1ccc(C(O)C2(C)CCCCC2)cc1CC |
| InChI | InChI=1S/C18H28O/c1-4-14-9-10-16(13-15(14)5-2)17(19)18(3)11-7-6-8-12-18/h9-10,13,17,19H,4-8,11-12H2,1-3H3 |
| InChIKey | DBAACBFFZOMZOT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |