(2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid

C12H16O3 — CID 57059044

IUPAC(2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid
SMILESCCc1ccc([C@@H](O)C(=O)O)cc1CC
InChIInChI=1S/C12H16O3/c1-3-8-5-6-10(7-9(8)4-2)11(13)12(14)15/h5-7,11,13H,3-4H2,1-2H3,(H,14,15)/t11-/m1/s1
InChIKeySUIRHPQVGKVTDX-LLVKDONJSA-N
MW208.26 g/mol
LogP1.93
Rot. Bonds4

About (2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid

(2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid (PubChem CID 57059044) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid.

Molecular Properties

Compound Name(2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid
PubChem CID57059044
Molecular FormulaC12H16O3
Molecular Weight208.26 g/mol
Exact Mass208.11
IUPAC Name(2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid
SMILESCCc1ccc([C@@H](O)C(=O)O)cc1CC
InChIInChI=1S/C12H16O3/c1-3-8-5-6-10(7-9(8)4-2)11(13)12(14)15/h5-7,11,13H,3-4H2,1-2H3,(H,14,15)/t11-/m1/s1
InChIKeySUIRHPQVGKVTDX-LLVKDONJSA-N
XLogP1.93
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.26
LogP ≤ 51.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid?
The IUPAC name of (2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid (CID 57059044) is (2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid.
What is the SMILES notation for (2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid?
The canonical SMILES for (2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid is CCc1ccc([C@@H](O)C(=O)O)cc1CC.
What is the InChIKey of (2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid?
The InChIKey is SUIRHPQVGKVTDX-LLVKDONJSA-N. The full InChI is InChI=1S/C12H16O3/c1-3-8-5-6-10(7-9(8)4-2)11(13)12(14)15/h5-7,11,13H,3-4H2,1-2H3,(H,14,15)/t11-/m1/s1.
What are the key properties of (2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid?
(2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid has a molecular weight of 208.26 g/mol, XLogP of 1.93, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,4-diethylphenyl)-2-hydroxyacetic acid is sourced from PubChem (CID 57059044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).