C12H14O5 — CID 134657390
2-hydroxy-2-[3-(hydroxymethyl)-4-(2-oxopropyl)phenyl]acetic acid (PubChem CID 134657390) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-hydroxy-2-[3-(hydroxymethyl)-4-(2-oxopropyl)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[3-(hydroxymethyl)-4-(2-oxopropyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 134657390 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-hydroxy-2-[3-(hydroxymethyl)-4-(2-oxopropyl)phenyl]acetic acid |
| SMILES | CC(=O)Cc1ccc(C(O)C(=O)O)cc1CO |
| InChI | InChI=1S/C12H14O5/c1-7(14)4-8-2-3-9(5-10(8)6-13)11(15)12(16)17/h2-3,5,11,13,15H,4,6H2,1H3,(H,16,17) |
| InChIKey | DVLXJXANOHXIAP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |