C12H11F3O5 — CID 134658013
2-hydroxy-2-[3-(2-oxopropyl)-4-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 134658013) has the molecular formula C12H11F3O5 and a molecular weight of 292.21 g/mol. Its IUPAC name is 2-hydroxy-2-[3-(2-oxopropyl)-4-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[3-(2-oxopropyl)-4-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 134658013 |
| Molecular Formula | C12H11F3O5 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-hydroxy-2-[3-(2-oxopropyl)-4-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | CC(=O)Cc1cc(C(O)C(=O)O)ccc1OC(F)(F)F |
| InChI | InChI=1S/C12H11F3O5/c1-6(16)4-8-5-7(10(17)11(18)19)2-3-9(8)20-12(13,14)15/h2-3,5,10,17H,4H2,1H3,(H,18,19) |
| InChIKey | AWMSPDPATQDGCV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |