C9H7F3O4S — CID 170999310
2-hydroxy-2-[3-sulfanyl-4-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 170999310) has the molecular formula C9H7F3O4S and a molecular weight of 268.21 g/mol. Its IUPAC name is 2-hydroxy-2-[3-sulfanyl-4-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[3-sulfanyl-4-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 170999310 |
| Molecular Formula | C9H7F3O4S |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 2-hydroxy-2-[3-sulfanyl-4-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | O=C(O)C(O)c1ccc(OC(F)(F)F)c(S)c1 |
| InChI | InChI=1S/C9H7F3O4S/c10-9(11,12)16-5-2-1-4(3-6(5)17)7(13)8(14)15/h1-3,7,13,17H,(H,14,15) |
| InChIKey | RIDYSCINBXGXST-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|