C9H6F3IO4 — CID 170998296
2-hydroxy-2-[2-iodo-3-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 170998296) has the molecular formula C9H6F3IO4 and a molecular weight of 362.04 g/mol. Its IUPAC name is 2-hydroxy-2-[2-iodo-3-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[2-iodo-3-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 170998296 |
| Molecular Formula | C9H6F3IO4 |
| Molecular Weight | 362.04 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | 2-hydroxy-2-[2-iodo-3-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | O=C(O)C(O)c1cccc(OC(F)(F)F)c1I |
| InChI | InChI=1S/C9H6F3IO4/c10-9(11,12)17-5-3-1-2-4(6(5)13)7(14)8(15)16/h1-3,7,14H,(H,15,16) |
| InChIKey | SEJYAAURTLRNRM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.04 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|