C10H12O5 — CID 54776000
2-(2,3-dimethoxyphenyl)-2-hydroxyacetic acid (PubChem CID 54776000) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2,3-dimethoxyphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 54776000 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-2-hydroxyacetic acid |
| SMILES | COc1cccc(C(O)C(=O)O)c1OC |
| InChI | InChI=1S/C10H12O5/c1-14-7-5-3-4-6(9(7)15-2)8(11)10(12)13/h3-5,8,11H,1-2H3,(H,12,13) |
| InChIKey | OODLUGWLLHDFCK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |